C21H27FN2 — CID 89265593
(3E,5E,7Z)-2-[4-(4-fluorophenyl)piperidin-1-yl]-6-methylnona-1,3,5,7-tetraen-5-amine (PubChem CID 89265593) has the molecular formula C21H27FN2 and a molecular weight of 326.46 g/mol. Its IUPAC name is (3E,5E,7Z)-2-[4-(4-fluorophenyl)piperidin-1-yl]-6-methylnona-1,3,5,7-tetraen-5-amine.
| Compound Name | (3E,5E,7Z)-2-[4-(4-fluorophenyl)piperidin-1-yl]-6-methylnona-1,3,5,7-tetraen-5-amine |
|---|---|
| PubChem CID | 89265593 |
| Molecular Formula | C21H27FN2 |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (3E,5E,7Z)-2-[4-(4-fluorophenyl)piperidin-1-yl]-6-methylnona-1,3,5,7-tetraen-5-amine |
| SMILES | C=C(/C=C/C(N)=C(C)\C=C/C)N1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H27FN2/c1-4-5-16(2)21(23)11-6-17(3)24-14-12-19(13-15-24)18-7-9-20(22)10-8-18/h4-11,19H,3,12-15,23H2,1-2H3/b5-4-,11-6+,21-16+ |
| InChIKey | KKESZBRCCJHSDA-CRSXGDBXSA-N |
| XLogP | 4.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|