C14H14N2O5 — CID 8926563
[(2R)-1-amino-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926563) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926563 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](OC(=O)[C@H](C)N1C(=O)c2ccccc2C1=O)C(N)=O |
| InChI | InChI=1S/C14H14N2O5/c1-7(14(20)21-8(2)11(15)17)16-12(18)9-5-3-4-6-10(9)13(16)19/h3-8H,1-2H3,(H2,15,17)/t7-,8+/m0/s1 |
| InChIKey | KLNAZRXGIHOWOT-JGVFFNPUSA-N |
| XLogP | 0.09 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|