C14H15N3O — CID 89265950
4-[(2E,4E)-5-amino-5-(3H-pyrrol-2-yl)penta-2,4-dien-2-yl]-1H-pyridin-2-one (PubChem CID 89265950) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(2E,4E)-5-amino-5-(3H-pyrrol-2-yl)penta-2,4-dien-2-yl]-1H-pyridin-2-one.
| Compound Name | 4-[(2E,4E)-5-amino-5-(3H-pyrrol-2-yl)penta-2,4-dien-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 89265950 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[(2E,4E)-5-amino-5-(3H-pyrrol-2-yl)penta-2,4-dien-2-yl]-1H-pyridin-2-one |
| SMILES | C/C(=C\C=C(\N)C1=NC=CC1)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C14H15N3O/c1-10(11-6-8-17-14(18)9-11)4-5-12(15)13-3-2-7-16-13/h2,4-9H,3,15H2,1H3,(H,17,18)/b10-4+,12-5+ |
| InChIKey | NBJAIWXFCUCMJD-JBZDOKMESA-N |
| XLogP | 1.98 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|