About [(E)-prop-1-enyl] N-methylethanimidothioate
[(E)-prop-1-enyl] N-methylethanimidothioate (PubChem CID 89266207) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is [(E)-prop-1-enyl] N-methylethanimidothioate.
Molecular Properties
| Compound Name | [(E)-prop-1-enyl] N-methylethanimidothioate |
| PubChem CID | 89266207 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | [(E)-prop-1-enyl] N-methylethanimidothioate |
| SMILES | C/C=C/S/C(C)=N/C |
| InChI | InChI=1S/C6H11NS/c1-4-5-8-6(2)7-3/h4-5H,1-3H3/b5-4+,7-6+ |
| InChIKey | DKBWTKBWRZOUDF-YTXTXJHMSA-N |
| XLogP | 2.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-prop-1-enyl] N-methylethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-prop-1-enyl] N-methylethanimidothioate?
The IUPAC name of [(E)-prop-1-enyl] N-methylethanimidothioate (CID 89266207) is [(E)-prop-1-enyl] N-methylethanimidothioate.
What is the SMILES notation for [(E)-prop-1-enyl] N-methylethanimidothioate?
The canonical SMILES for [(E)-prop-1-enyl] N-methylethanimidothioate is C/C=C/S/C(C)=N/C.
What is the InChIKey of [(E)-prop-1-enyl] N-methylethanimidothioate?
The InChIKey is DKBWTKBWRZOUDF-YTXTXJHMSA-N. The full InChI is InChI=1S/C6H11NS/c1-4-5-8-6(2)7-3/h4-5H,1-3H3/b5-4+,7-6+.
What are the key properties of [(E)-prop-1-enyl] N-methylethanimidothioate?
[(E)-prop-1-enyl] N-methylethanimidothioate has a molecular weight of 129.23 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-prop-1-enyl] N-methylethanimidothioate is sourced from PubChem (CID 89266207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).