C21H31F3N2O10S — CID 89266315
[3-[1-(2,4-dioxopyrimidin-1-yl)ethoxy]-2,4-bis(oxan-2-yloxy)butyl] trifluoromethanesulfonate (PubChem CID 89266315) has the molecular formula C21H31F3N2O10S and a molecular weight of 560.54 g/mol. Its IUPAC name is [3-[1-(2,4-dioxopyrimidin-1-yl)ethoxy]-2,4-bis(oxan-2-yloxy)butyl] trifluoromethanesulfonate.
| Compound Name | [3-[1-(2,4-dioxopyrimidin-1-yl)ethoxy]-2,4-bis(oxan-2-yloxy)butyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89266315 |
| Molecular Formula | C21H31F3N2O10S |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | [3-[1-(2,4-dioxopyrimidin-1-yl)ethoxy]-2,4-bis(oxan-2-yloxy)butyl] trifluoromethanesulfonate |
| SMILES | CC(OC(COC1CCCCO1)C(COS(=O)(=O)C(F)(F)F)OC1CCCCO1)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C21H31F3N2O10S/c1-14(26-9-8-17(27)25-20(26)28)35-15(12-33-18-6-2-4-10-31-18)16(36-19-7-3-5-11-32-19)13-34-37(29,30)21(22,23)24/h8-9,14-16,18-19H,2-7,10-13H2,1H3,(H,25,27,28) |
| InChIKey | WJJGCYVYPXXWNE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|