About [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone
[4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone (PubChem CID 89266428) has the molecular formula C13H15N5O2S
and a molecular weight of 305.36 g/mol. Its IUPAC name is [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone.
Molecular Properties
| Compound Name | [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone |
| PubChem CID | 89266428 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone |
| SMILES | Cc1cc(Nc2nc(CS)ncc2C(=O)C2CO2)n(C)n1 |
| InChI | InChI=1S/C13H15N5O2S/c1-7-3-11(18(2)17-7)16-13-8(12(19)9-5-20-9)4-14-10(6-21)15-13/h3-4,9,21H,5-6H2,1-2H3,(H,14,15,16) |
| InChIKey | INFBLZVSZXGAFA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone?
The IUPAC name of [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone (CID 89266428) is [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone.
What is the SMILES notation for [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone?
The canonical SMILES for [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone is Cc1cc(Nc2nc(CS)ncc2C(=O)C2CO2)n(C)n1.
What is the InChIKey of [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone?
The InChIKey is INFBLZVSZXGAFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2S/c1-7-3-11(18(2)17-7)16-13-8(12(19)9-5-20-9)4-14-10(6-21)15-13/h3-4,9,21H,5-6H2,1-2H3,(H,14,15,16).
What are the key properties of [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone?
[4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone has a molecular weight of 305.36 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,5-dimethylpyrazol-3-yl)amino]-2-(sulfanylmethyl)pyrimidin-5-yl]-(oxiran-2-yl)methanone is sourced from PubChem (CID 89266428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).