C45H51N4O7+ — CID 89266889
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-[[3-[5-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentoxy]phenyl]-phenylmethyl]carbamate (PubChem CID 89266889) has the molecular formula C45H51N4O7+ and a molecular weight of 759.92 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-[[3-[5-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentoxy]phenyl]-phenylmethyl]carbamate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-[[3-[5-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentoxy]phenyl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 89266889 |
| Molecular Formula | C45H51N4O7+ |
| Molecular Weight | 759.92 g/mol |
| Exact Mass | 759.38 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-[[3-[5-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentoxy]phenyl]-phenylmethyl]carbamate |
| SMILES | O=C(NC(c1ccccc1)c1cccc(OCCCCCNCC(O)c2ccc(O)c3[nH]c(=O)ccc23)c1)O[C@H]1C[N+]2(CC(=O)c3ccccc3)CCC1CC2 |
| InChI | InChI=1S/C45H50N4O7/c50-38-19-17-36(37-18-20-42(53)47-44(37)38)39(51)28-46-23-8-3-9-26-55-35-16-10-15-34(27-35)43(33-13-6-2-7-14-33)48-45(54)56-41-30-49(24-21-32(41)22-25-49)29-40(52)31-11-4-1-5-12-31/h1-2,4-7,10-20,27,32,39,41,43,46,51H,3,8-9,21-26,28-30H2,(H2-,47,48,50,53,54)/p+1/t32?,39?,41-,43?,49?/m0/s1 |
| InChIKey | XVRYIQRVIULCCW-HWLLSEEZSA-O |
| XLogP | 6.41 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.92 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|