About piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate
piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate (PubChem CID 89266924) has the molecular formula C27H35NO5S
and a molecular weight of 485.65 g/mol. Its IUPAC name is piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate |
| PubChem CID | 89266924 |
| Molecular Formula | C27H35NO5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C(=O)OCC2CCNCC2)(c2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H35NO5S/c1-21-12-14-25(15-13-21)34(30,31)33-27(23-8-4-2-5-9-23,24-10-6-3-7-11-24)26(29)32-20-22-16-18-28-19-17-22/h2,4-5,8-9,12-15,22,24,28H,3,6-7,10-11,16-20H2,1H3 |
| InChIKey | LQBONEZCFBMMMU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate?
The IUPAC name of piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate (CID 89266924) is piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate.
What is the SMILES notation for piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate?
The canonical SMILES for piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate is Cc1ccc(S(=O)(=O)OC(C(=O)OCC2CCNCC2)(c2ccccc2)C2CCCCC2)cc1.
What is the InChIKey of piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate?
The InChIKey is LQBONEZCFBMMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35NO5S/c1-21-12-14-25(15-13-21)34(30,31)33-27(23-8-4-2-5-9-23,24-10-6-3-7-11-24)26(29)32-20-22-16-18-28-19-17-22/h2,4-5,8-9,12-15,22,24,28H,3,6-7,10-11,16-20H2,1H3.
What are the key properties of piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate?
piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate has a molecular weight of 485.65 g/mol, XLogP of 4.72, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl 2-cyclohexyl-2-(4-methylphenyl)sulfonyloxy-2-phenylacetate is sourced from PubChem (CID 89266924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).