C36H48F2N3O8PS+2 — CID 89267469
[5-[4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-sulfophenyl]-5-oxopentyl]-[4-[3-(methoxyphosphanylamino)propyl-dimethylazaniumyl]butyl]-dimethylazanium (PubChem CID 89267469) has the molecular formula C36H48F2N3O8PS+2 and a molecular weight of 751.83 g/mol. Its IUPAC name is [5-[4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-sulfophenyl]-5-oxopentyl]-[4-[3-(methoxyphosphanylamino)propyl-dimethylazaniumyl]butyl]-dimethylazanium.
| Compound Name | [5-[4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-sulfophenyl]-5-oxopentyl]-[4-[3-(methoxyphosphanylamino)propyl-dimethylazaniumyl]butyl]-dimethylazanium |
|---|---|
| PubChem CID | 89267469 |
| Molecular Formula | C36H48F2N3O8PS+2 |
| Molecular Weight | 751.83 g/mol |
| Exact Mass | 751.29 |
| IUPAC Name | [5-[4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-sulfophenyl]-5-oxopentyl]-[4-[3-(methoxyphosphanylamino)propyl-dimethylazaniumyl]butyl]-dimethylazanium |
| SMILES | COPNCCC[N+](C)(C)CCCC[N+](C)(C)CCCCC(=O)c1ccc(-c2c3cc(F)c(=O)cc-3oc3cc(O)c(F)cc23)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C36H46F2N3O8PS/c1-40(2,16-8-9-17-41(3,4)18-10-14-39-50-48-5)15-7-6-11-30(42)24-12-13-25(35(19-24)51(45,46)47)36-26-20-28(37)31(43)22-33(26)49-34-23-32(44)29(38)21-27(34)36/h12-13,19-23,39,50H,6-11,14-18H2,1-5H3/p+2 |
| InChIKey | HTRALENDYPJSHY-UHFFFAOYSA-P |
| XLogP | 6.22 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|