About (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one
(5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one (PubChem CID 89267675) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one.
Molecular Properties
| Compound Name | (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one |
| PubChem CID | 89267675 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one |
| SMILES | C/C=C\C=C(/CC)C(=O)CC(C)=C1CCC1 |
| InChI | InChI=1S/C15H22O/c1-4-6-8-13(5-2)15(16)11-12(3)14-9-7-10-14/h4,6,8H,5,7,9-11H2,1-3H3/b6-4-,13-8+ |
| InChIKey | YPFURTZAIJIUCM-RUMQPUKBSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one?
The IUPAC name of (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one (CID 89267675) is (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one.
What is the SMILES notation for (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one?
The canonical SMILES for (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one is C/C=C\C=C(/CC)C(=O)CC(C)=C1CCC1.
What is the InChIKey of (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one?
The InChIKey is YPFURTZAIJIUCM-RUMQPUKBSA-N. The full InChI is InChI=1S/C15H22O/c1-4-6-8-13(5-2)15(16)11-12(3)14-9-7-10-14/h4,6,8H,5,7,9-11H2,1-3H3/b6-4-,13-8+.
What are the key properties of (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one?
(5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one has a molecular weight of 218.34 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,7Z)-2-cyclobutylidene-5-ethylnona-5,7-dien-4-one is sourced from PubChem (CID 89267675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).