C25H31F6N3O3S — CID 89268409
(1'R,4R,10'S)-5'-[(E)-3-[1-oxido-4-(trifluoromethyl)piperidin-1-ium-1-yl]prop-1-enyl]-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 89268409) has the molecular formula C25H31F6N3O3S and a molecular weight of 567.60 g/mol. Its IUPAC name is (1'R,4R,10'S)-5'-[(E)-3-[1-oxido-4-(trifluoromethyl)piperidin-1-ium-1-yl]prop-1-enyl]-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | (1'R,4R,10'S)-5'-[(E)-3-[1-oxido-4-(trifluoromethyl)piperidin-1-ium-1-yl]prop-1-enyl]-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 89268409 |
| Molecular Formula | C25H31F6N3O3S |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | (1'R,4R,10'S)-5'-[(E)-3-[1-oxido-4-(trifluoromethyl)piperidin-1-ium-1-yl]prop-1-enyl]-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | O=S1(=O)N[C@@]2(CN1CC(F)(F)F)[C@@H]1CC[C@H]2Cc2ccc(/C=C/C[N+]3([O-])CCC(C(F)(F)F)CC3)cc2C1 |
| InChI | InChI=1S/C25H31F6N3O3S/c26-24(27,28)16-33-15-23(32-38(33,36)37)21-5-6-22(23)14-19-12-17(3-4-18(19)13-21)2-1-9-34(35)10-7-20(8-11-34)25(29,30)31/h1-4,12,20-22,32H,5-11,13-16H2/b2-1+/t20?,21-,22+,23+,34?/m0/s1 |
| InChIKey | VTZQUXUQSWFCSF-AIRNAZEJSA-N |
| XLogP | 4.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|