About 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine
2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine (PubChem CID 89268421) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine |
| PubChem CID | 89268421 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine |
| SMILES | NCCC1=CNC2C=CC=CC12 |
| InChI | InChI=1S/C10H14N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,9-10,12H,5-6,11H2 |
| InChIKey | AFNGJQNQVHNCIT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine?
The IUPAC name of 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine (CID 89268421) is 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine.
What is the SMILES notation for 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine?
The canonical SMILES for 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine is NCCC1=CNC2C=CC=CC12.
What is the InChIKey of 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine?
The InChIKey is AFNGJQNQVHNCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,9-10,12H,5-6,11H2.
What are the key properties of 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine?
2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine has a molecular weight of 162.24 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3a,7a-dihydro-1H-indol-3-yl)ethanamine is sourced from PubChem (CID 89268421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).