C33H32FNO3 — CID 89268622
(5R)-10-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-6,9-dioxapentacyclo[9.8.0.02,7.05,7.012,17]nonadeca-11,16-dien-15-one (PubChem CID 89268622) has the molecular formula C33H32FNO3 and a molecular weight of 509.62 g/mol. Its IUPAC name is (5R)-10-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-6,9-dioxapentacyclo[9.8.0.02,7.05,7.012,17]nonadeca-11,16-dien-15-one.
| Compound Name | (5R)-10-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-6,9-dioxapentacyclo[9.8.0.02,7.05,7.012,17]nonadeca-11,16-dien-15-one |
|---|---|
| PubChem CID | 89268622 |
| Molecular Formula | C33H32FNO3 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | (5R)-10-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-6,9-dioxapentacyclo[9.8.0.02,7.05,7.012,17]nonadeca-11,16-dien-15-one |
| SMILES | CN(C)c1ccc(C2OCC34O[C@@]3(C#Cc3ccc(F)cc3)CCC4C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C33H32FNO3/c1-35(2)25-10-5-22(6-11-25)31-30-27-14-12-26(36)19-23(27)7-13-28(30)29-16-18-32(33(29,38-32)20-37-31)17-15-21-3-8-24(34)9-4-21/h3-6,8-11,19,28-29,31H,7,12-14,16,18,20H2,1-2H3/t28?,29?,31?,32-,33?/m0/s1 |
| InChIKey | HGZHCMFBGXFYRP-GWNWWDDLSA-N |
| XLogP | 5.93 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|