C25H34O4 — CID 89268648
[1-[4-(2-cyclohexa-1,3-dien-1-ylpropan-2-yl)cyclohexa-1,3-dien-1-yl]oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate (PubChem CID 89268648) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is [1-[4-(2-cyclohexa-1,3-dien-1-ylpropan-2-yl)cyclohexa-1,3-dien-1-yl]oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[4-(2-cyclohexa-1,3-dien-1-ylpropan-2-yl)cyclohexa-1,3-dien-1-yl]oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89268648 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [1-[4-(2-cyclohexa-1,3-dien-1-ylpropan-2-yl)cyclohexa-1,3-dien-1-yl]oxy-3-prop-2-enoxypropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=CCOCC(COC1=CC=C(C(C)(C)C2=CC=CCC2)CC1)OC(=O)C(=C)C |
| InChI | InChI=1S/C25H34O4/c1-6-16-27-17-23(29-24(26)19(2)3)18-28-22-14-12-21(13-15-22)25(4,5)20-10-8-7-9-11-20/h6-8,10,12,14,23H,1-2,9,11,13,15-18H2,3-5H3 |
| InChIKey | UHENLZQQMVMCFW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|