About 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde
6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde (PubChem CID 89268689) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde.
Molecular Properties
| Compound Name | 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde |
| PubChem CID | 89268689 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde |
| SMILES | C=C=CC1=NCCC=C1C=O |
| InChI | InChI=1S/C9H9NO/c1-2-4-9-8(7-11)5-3-6-10-9/h4-5,7H,1,3,6H2 |
| InChIKey | ALHXKIFIZCLKNS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde?
The IUPAC name of 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde (CID 89268689) is 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde.
What is the SMILES notation for 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde?
The canonical SMILES for 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde is C=C=CC1=NCCC=C1C=O.
What is the InChIKey of 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde?
The InChIKey is ALHXKIFIZCLKNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-2-4-9-8(7-11)5-3-6-10-9/h4-5,7H,1,3,6H2.
What are the key properties of 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde?
6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde has a molecular weight of 147.18 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propa-1,2-dienyl-2,3-dihydropyridine-5-carbaldehyde is sourced from PubChem (CID 89268689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).