C26H44O5Si — CID 89268790
[(2S,3S,4E,6R,7S,10R)-3,7-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 89268790) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is [(2S,3S,4E,6R,7S,10R)-3,7-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6R,7S,10R)-3,7-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 89268790 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | [(2S,3S,4E,6R,7S,10R)-3,7-dimethyl-12-oxo-2-[(2E)-penta-2,4-dien-2-yl]-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | C=C/C=C(\C)[C@H]1OC(=O)C[C@H](O[Si](CC)(CC)CC)CC[C@H](C)[C@@H](OC(C)=O)/C=C/[C@@H]1C |
| InChI | InChI=1S/C26H44O5Si/c1-9-13-20(6)26-21(7)15-17-24(29-22(8)27)19(5)14-16-23(18-25(28)30-26)31-32(10-2,11-3)12-4/h9,13,15,17,19,21,23-24,26H,1,10-12,14,16,18H2,2-8H3/b17-15+,20-13+/t19-,21-,23+,24-,26+/m0/s1 |
| InChIKey | IBAXLMFUTFOGGR-SDDOAVJBSA-N |
| XLogP | 6.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|