C22H28O4S2 — CID 89269224
(3S,7S)-1,8-bis(ethenylsulfanyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene (PubChem CID 89269224) has the molecular formula C22H28O4S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is (3S,7S)-1,8-bis(ethenylsulfanyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene.
| Compound Name | (3S,7S)-1,8-bis(ethenylsulfanyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene |
|---|---|
| PubChem CID | 89269224 |
| Molecular Formula | C22H28O4S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (3S,7S)-1,8-bis(ethenylsulfanyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene |
| SMILES | C=CSC1=CC2C3C=CC(SC=C)(C4OC(C)(C)OC34)C2[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C22H28O4S2/c1-7-27-14-11-13-12-9-10-22(28-8-2,19-16(12)23-21(5,6)26-19)15(13)18-17(14)24-20(3,4)25-18/h7-13,15-19H,1-2H2,3-6H3/t12?,13?,15?,16?,17-,18+,19?,22?/m1/s1 |
| InChIKey | MPFJHUOITMZAAP-WHYYFLSTSA-N |
| XLogP | 4.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|