About [(2S,3S)-3-ethenylpiperidin-2-yl]methanol
[(2S,3S)-3-ethenylpiperidin-2-yl]methanol (PubChem CID 89269282) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is [(2S,3S)-3-ethenylpiperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,3S)-3-ethenylpiperidin-2-yl]methanol |
| PubChem CID | 89269282 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | [(2S,3S)-3-ethenylpiperidin-2-yl]methanol |
| SMILES | C=C[C@@H]1CCCN[C@@H]1CO |
| InChI | InChI=1S/C8H15NO/c1-2-7-4-3-5-9-8(7)6-10/h2,7-10H,1,3-6H2/t7-,8-/m1/s1 |
| InChIKey | XZYNJHRKSGNRLU-HTQZYQBOSA-N |
| XLogP | 0.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-3-ethenylpiperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-ethenylpiperidin-2-yl]methanol?
The IUPAC name of [(2S,3S)-3-ethenylpiperidin-2-yl]methanol (CID 89269282) is [(2S,3S)-3-ethenylpiperidin-2-yl]methanol.
What is the SMILES notation for [(2S,3S)-3-ethenylpiperidin-2-yl]methanol?
The canonical SMILES for [(2S,3S)-3-ethenylpiperidin-2-yl]methanol is C=C[C@@H]1CCCN[C@@H]1CO.
What is the InChIKey of [(2S,3S)-3-ethenylpiperidin-2-yl]methanol?
The InChIKey is XZYNJHRKSGNRLU-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H15NO/c1-2-7-4-3-5-9-8(7)6-10/h2,7-10H,1,3-6H2/t7-,8-/m1/s1.
What are the key properties of [(2S,3S)-3-ethenylpiperidin-2-yl]methanol?
[(2S,3S)-3-ethenylpiperidin-2-yl]methanol has a molecular weight of 141.21 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-ethenylpiperidin-2-yl]methanol is sourced from PubChem (CID 89269282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).