About 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene
2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene (PubChem CID 89269304) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene |
| PubChem CID | 89269304 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene |
| SMILES | CC(OC1=CCCC=C1)OC1C=CC=CC1 |
| InChI | InChI=1S/C14H18O2/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14/h2,4-6,8,10-13H,3,7,9H2,1H3 |
| InChIKey | GUFZFCZBFWNFSJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene?
The IUPAC name of 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene (CID 89269304) is 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene.
What is the SMILES notation for 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene?
The canonical SMILES for 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene is CC(OC1=CCCC=C1)OC1C=CC=CC1.
What is the InChIKey of 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene?
The InChIKey is GUFZFCZBFWNFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14/h2,4-6,8,10-13H,3,7,9H2,1H3.
What are the key properties of 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene?
2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene has a molecular weight of 218.30 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohexa-2,4-dien-1-yloxyethoxy)cyclohexa-1,3-diene is sourced from PubChem (CID 89269304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).