About 5-bromo-3-iodo-2,3-dihydropyridin-2-amine
5-bromo-3-iodo-2,3-dihydropyridin-2-amine (PubChem CID 89269331) has the molecular formula C5H6BrIN2
and a molecular weight of 300.93 g/mol. Its IUPAC name is 5-bromo-3-iodo-2,3-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-3-iodo-2,3-dihydropyridin-2-amine |
| PubChem CID | 89269331 |
| Molecular Formula | C5H6BrIN2 |
| Molecular Weight | 300.93 g/mol |
| Exact Mass | 299.88 |
| IUPAC Name | 5-bromo-3-iodo-2,3-dihydropyridin-2-amine |
| SMILES | NC1N=CC(Br)=CC1I |
| InChI | InChI=1S/C5H6BrIN2/c6-3-1-4(7)5(8)9-2-3/h1-2,4-5H,8H2 |
| InChIKey | XIYKCACWQDAPMW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.93 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-iodo-2,3-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-iodo-2,3-dihydropyridin-2-amine?
The IUPAC name of 5-bromo-3-iodo-2,3-dihydropyridin-2-amine (CID 89269331) is 5-bromo-3-iodo-2,3-dihydropyridin-2-amine.
What is the SMILES notation for 5-bromo-3-iodo-2,3-dihydropyridin-2-amine?
The canonical SMILES for 5-bromo-3-iodo-2,3-dihydropyridin-2-amine is NC1N=CC(Br)=CC1I.
What is the InChIKey of 5-bromo-3-iodo-2,3-dihydropyridin-2-amine?
The InChIKey is XIYKCACWQDAPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrIN2/c6-3-1-4(7)5(8)9-2-3/h1-2,4-5H,8H2.
What are the key properties of 5-bromo-3-iodo-2,3-dihydropyridin-2-amine?
5-bromo-3-iodo-2,3-dihydropyridin-2-amine has a molecular weight of 300.93 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-iodo-2,3-dihydropyridin-2-amine is sourced from PubChem (CID 89269331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).