C19H30O — CID 89269407
6-[[(3Z)-3,8-dimethylnona-1,3,8-trien-5-yl]oxymethyl]-1-methylcyclohexene (PubChem CID 89269407) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 6-[[(3Z)-3,8-dimethylnona-1,3,8-trien-5-yl]oxymethyl]-1-methylcyclohexene.
| Compound Name | 6-[[(3Z)-3,8-dimethylnona-1,3,8-trien-5-yl]oxymethyl]-1-methylcyclohexene |
|---|---|
| PubChem CID | 89269407 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 6-[[(3Z)-3,8-dimethylnona-1,3,8-trien-5-yl]oxymethyl]-1-methylcyclohexene |
| SMILES | C=C/C(C)=C\C(CCC(=C)C)OCC1CCCC=C1C |
| InChI | InChI=1S/C19H30O/c1-6-16(4)13-19(12-11-15(2)3)20-14-18-10-8-7-9-17(18)5/h6,9,13,18-19H,1-2,7-8,10-12,14H2,3-5H3/b16-13- |
| InChIKey | VMXGPLYBISUGCF-SSZFMOIBSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|