C10H13N — CID 89269458
(2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraen-1-imine (PubChem CID 89269458) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraen-1-imine.
| Compound Name | (2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraen-1-imine |
|---|---|
| PubChem CID | 89269458 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (2E,4Z)-2,6-dimethylocta-2,4,6,7-tetraen-1-imine |
| SMILES | [H]/N=C/C(C)=C/C=C\C(C)=C=C |
| InChI | InChI=1S/C10H13N/c1-4-9(2)6-5-7-10(3)8-11/h5-8,11H,1H2,2-3H3/b6-5-,10-7+,11-8+ |
| InChIKey | ZAPNWUSLWUPOQK-HKAXXRRESA-N |
| XLogP | 2.87 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|