C20H24N2O5S — CID 8926953
(2S)-N-(2-ethoxyphenyl)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 8926953) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is (2S)-N-(2-ethoxyphenyl)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2-ethoxyphenyl)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 8926953 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S)-N-(2-ethoxyphenyl)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-3-27-19-9-5-4-7-17(19)21-20(23)18-8-6-14-22(18)28(24,25)16-12-10-15(26-2)11-13-16/h4-5,7,9-13,18H,3,6,8,14H2,1-2H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | XTPYGSUIDIOZTF-SFHVURJKSA-N |
| XLogP | 2.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |