About 10-tricyclo[5.2.1.02,6]decanylmethanethiol
10-tricyclo[5.2.1.02,6]decanylmethanethiol (PubChem CID 89269656) has the molecular formula C11H18S
and a molecular weight of 182.33 g/mol. Its IUPAC name is 10-tricyclo[5.2.1.02,6]decanylmethanethiol.
Molecular Properties
| Compound Name | 10-tricyclo[5.2.1.02,6]decanylmethanethiol |
| PubChem CID | 89269656 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 10-tricyclo[5.2.1.02,6]decanylmethanethiol |
| SMILES | SCC1C2CCC1C1CCCC21 |
| InChI | InChI=1S/C11H18S/c12-6-11-9-4-5-10(11)8-3-1-2-7(8)9/h7-12H,1-6H2 |
| InChIKey | ZHGQMOSBGZQDPK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 10-tricyclo[5.2.1.02,6]decanylmethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-tricyclo[5.2.1.02,6]decanylmethanethiol?
The IUPAC name of 10-tricyclo[5.2.1.02,6]decanylmethanethiol (CID 89269656) is 10-tricyclo[5.2.1.02,6]decanylmethanethiol.
What is the SMILES notation for 10-tricyclo[5.2.1.02,6]decanylmethanethiol?
The canonical SMILES for 10-tricyclo[5.2.1.02,6]decanylmethanethiol is SCC1C2CCC1C1CCCC21.
What is the InChIKey of 10-tricyclo[5.2.1.02,6]decanylmethanethiol?
The InChIKey is ZHGQMOSBGZQDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18S/c12-6-11-9-4-5-10(11)8-3-1-2-7(8)9/h7-12H,1-6H2.
What are the key properties of 10-tricyclo[5.2.1.02,6]decanylmethanethiol?
10-tricyclo[5.2.1.02,6]decanylmethanethiol has a molecular weight of 182.33 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-tricyclo[5.2.1.02,6]decanylmethanethiol is sourced from PubChem (CID 89269656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).