About (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol
(7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol (PubChem CID 89269698) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol.
Molecular Properties
| Compound Name | (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol |
| PubChem CID | 89269698 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol |
| SMILES | CCC1=CC2(O)C(O)[C@@H](O)C2O1 |
| InChI | InChI=1S/C8H12O4/c1-2-4-3-8(11)6(10)5(9)7(8)12-4/h3,5-7,9-11H,2H2,1H3/t5-,6?,7?,8?/m1/s1 |
| InChIKey | RJPZVTCNBSWUHE-NIYQRSRNSA-N |
| XLogP | -0.85 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol?
The IUPAC name of (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol (CID 89269698) is (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol.
What is the SMILES notation for (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol?
The canonical SMILES for (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol is CCC1=CC2(O)C(O)[C@@H](O)C2O1.
What is the InChIKey of (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol?
The InChIKey is RJPZVTCNBSWUHE-NIYQRSRNSA-N. The full InChI is InChI=1S/C8H12O4/c1-2-4-3-8(11)6(10)5(9)7(8)12-4/h3,5-7,9-11H,2H2,1H3/t5-,6?,7?,8?/m1/s1.
What are the key properties of (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol?
(7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol has a molecular weight of 172.18 g/mol, XLogP of -0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-3-ethyl-2-oxabicyclo[3.2.0]hept-3-ene-5,6,7-triol is sourced from PubChem (CID 89269698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).