About methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate
methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate (PubChem CID 89269777) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate.
Molecular Properties
| Compound Name | methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate |
| PubChem CID | 89269777 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate |
| SMILES | COC(=O)C1CC2=CC=C1C2 |
| InChI | InChI=1S/C9H10O2/c1-11-9(10)8-5-6-2-3-7(8)4-6/h2-3,8H,4-5H2,1H3 |
| InChIKey | JWGSDOIVAPRRRI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate?
The IUPAC name of methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate (CID 89269777) is methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate.
What is the SMILES notation for methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate?
The canonical SMILES for methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate is COC(=O)C1CC2=CC=C1C2.
What is the InChIKey of methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate?
The InChIKey is JWGSDOIVAPRRRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-11-9(10)8-5-6-2-3-7(8)4-6/h2-3,8H,4-5H2,1H3.
What are the key properties of methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate?
methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate has a molecular weight of 150.18 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl bicyclo[2.2.1]hepta-1(6),4-diene-2-carboxylate is sourced from PubChem (CID 89269777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).