About [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine
[5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine (PubChem CID 89270131) has the molecular formula C8H9F4N
and a molecular weight of 195.16 g/mol. Its IUPAC name is [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine |
| PubChem CID | 89270131 |
| Molecular Formula | C8H9F4N |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine |
| SMILES | NCC1=C(C(F)(F)F)CCC(F)=C1 |
| InChI | InChI=1S/C8H9F4N/c9-6-1-2-7(8(10,11)12)5(3-6)4-13/h3H,1-2,4,13H2 |
| InChIKey | JAFISLAETCIYKU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine?
The IUPAC name of [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine (CID 89270131) is [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine.
What is the SMILES notation for [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine?
The canonical SMILES for [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine is NCC1=C(C(F)(F)F)CCC(F)=C1.
What is the InChIKey of [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine?
The InChIKey is JAFISLAETCIYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F4N/c9-6-1-2-7(8(10,11)12)5(3-6)4-13/h3H,1-2,4,13H2.
What are the key properties of [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine?
[5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine has a molecular weight of 195.16 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine is sourced from PubChem (CID 89270131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).