About (5-fluorocyclohexa-1,3-dien-1-yl)methanamine
(5-fluorocyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 89270182) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is (5-fluorocyclohexa-1,3-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (5-fluorocyclohexa-1,3-dien-1-yl)methanamine |
| PubChem CID | 89270182 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (5-fluorocyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | NCC1=CC=CC(F)C1 |
| InChI | InChI=1S/C7H10FN/c8-7-3-1-2-6(4-7)5-9/h1-3,7H,4-5,9H2 |
| InChIKey | VKCPTHJJTKBQNM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5-fluorocyclohexa-1,3-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluorocyclohexa-1,3-dien-1-yl)methanamine?
The IUPAC name of (5-fluorocyclohexa-1,3-dien-1-yl)methanamine (CID 89270182) is (5-fluorocyclohexa-1,3-dien-1-yl)methanamine.
What is the SMILES notation for (5-fluorocyclohexa-1,3-dien-1-yl)methanamine?
The canonical SMILES for (5-fluorocyclohexa-1,3-dien-1-yl)methanamine is NCC1=CC=CC(F)C1.
What is the InChIKey of (5-fluorocyclohexa-1,3-dien-1-yl)methanamine?
The InChIKey is VKCPTHJJTKBQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN/c8-7-3-1-2-6(4-7)5-9/h1-3,7H,4-5,9H2.
What are the key properties of (5-fluorocyclohexa-1,3-dien-1-yl)methanamine?
(5-fluorocyclohexa-1,3-dien-1-yl)methanamine has a molecular weight of 127.16 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluorocyclohexa-1,3-dien-1-yl)methanamine is sourced from PubChem (CID 89270182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).