C7H9IN2 — CID 89270361
5-iodo-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 89270361) has the molecular formula C7H9IN2 and a molecular weight of 248.07 g/mol. Its IUPAC name is 5-iodo-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-iodo-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 89270361 |
| Molecular Formula | C7H9IN2 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 5-iodo-2,3,5,6-tetrahydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | IC1C=C2CCNC2=NC1 |
| InChI | InChI=1S/C7H9IN2/c8-6-3-5-1-2-9-7(5)10-4-6/h3,6H,1-2,4H2,(H,9,10) |
| InChIKey | IIPPGGRREQHUKW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|