About 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine
4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine (PubChem CID 89270451) has the molecular formula C8H8ClN
and a molecular weight of 153.61 g/mol. Its IUPAC name is 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine.
Molecular Properties
| Compound Name | 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine |
| PubChem CID | 89270451 |
| Molecular Formula | C8H8ClN |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine |
| SMILES | NC1Cc2ccc(Cl)c1c2 |
| InChI | InChI=1S/C8H8ClN/c9-7-2-1-5-3-6(7)8(10)4-5/h1-3,8H,4,10H2 |
| InChIKey | ZYLQPDCEHZCAET-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine?
The IUPAC name of 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine (CID 89270451) is 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine.
What is the SMILES notation for 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine?
The canonical SMILES for 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine is NC1Cc2ccc(Cl)c1c2.
What is the InChIKey of 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine?
The InChIKey is ZYLQPDCEHZCAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN/c9-7-2-1-5-3-6(7)8(10)4-5/h1-3,8H,4,10H2.
What are the key properties of 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine?
4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine has a molecular weight of 153.61 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobicyclo[3.2.1]octa-1(8),2,4-trien-6-amine is sourced from PubChem (CID 89270451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).