C9H11F4N — CID 89270489
(2Z,4E,6Z)-3-fluoro-5-(trifluoromethyl)octa-2,4,6-trien-1-amine (PubChem CID 89270489) has the molecular formula C9H11F4N and a molecular weight of 209.19 g/mol. Its IUPAC name is (2Z,4E,6Z)-3-fluoro-5-(trifluoromethyl)octa-2,4,6-trien-1-amine.
| Compound Name | (2Z,4E,6Z)-3-fluoro-5-(trifluoromethyl)octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 89270489 |
| Molecular Formula | C9H11F4N |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | (2Z,4E,6Z)-3-fluoro-5-(trifluoromethyl)octa-2,4,6-trien-1-amine |
| SMILES | C/C=C\C(=C/C(F)=C/CN)C(F)(F)F |
| InChI | InChI=1S/C9H11F4N/c1-2-3-7(9(11,12)13)6-8(10)4-5-14/h2-4,6H,5,14H2,1H3/b3-2-,7-6+,8-4- |
| InChIKey | SICYVWYNARXATI-JZUARBNZSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|