C19H31N7O — CID 89270637
2-N-[(Z)-aminodiazenyl]-2-N-cyclopentyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine (PubChem CID 89270637) has the molecular formula C19H31N7O and a molecular weight of 373.51 g/mol. Its IUPAC name is 2-N-[(Z)-aminodiazenyl]-2-N-cyclopentyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine.
| Compound Name | 2-N-[(Z)-aminodiazenyl]-2-N-cyclopentyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 89270637 |
| Molecular Formula | C19H31N7O |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 2-N-[(Z)-aminodiazenyl]-2-N-cyclopentyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine |
| SMILES | C=C(C(NCCCn1ccnc1)[C@@H]1CCC=CO1)N(/N=N\N)C1CCCC1 |
| InChI | InChI=1S/C19H31N7O/c1-16(26(24-23-20)17-7-2-3-8-17)19(18-9-4-5-14-27-18)22-10-6-12-25-13-11-21-15-25/h5,11,13-15,17-19,22H,1-4,6-10,12H2,(H2,20,24)/t18-,19?/m0/s1 |
| InChIKey | XTZUMGIPFHXNDT-OYKVQYDMSA-N |
| XLogP | 2.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|