C23H27F3N4 — CID 89270664
N-[(1Z,5Z,7E)-8-amino-2-ethenyl-7-fluoro-5-[1-(methylamino)ethenyl]-4-methylideneocta-1,5,7-trienyl]-N'-[(2,5-difluorophenyl)methyl]ethanimidamide (PubChem CID 89270664) has the molecular formula C23H27F3N4 and a molecular weight of 416.49 g/mol. Its IUPAC name is N-[(1Z,5Z,7E)-8-amino-2-ethenyl-7-fluoro-5-[1-(methylamino)ethenyl]-4-methylideneocta-1,5,7-trienyl]-N'-[(2,5-difluorophenyl)methyl]ethanimidamide.
| Compound Name | N-[(1Z,5Z,7E)-8-amino-2-ethenyl-7-fluoro-5-[1-(methylamino)ethenyl]-4-methylideneocta-1,5,7-trienyl]-N'-[(2,5-difluorophenyl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 89270664 |
| Molecular Formula | C23H27F3N4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[(1Z,5Z,7E)-8-amino-2-ethenyl-7-fluoro-5-[1-(methylamino)ethenyl]-4-methylideneocta-1,5,7-trienyl]-N'-[(2,5-difluorophenyl)methyl]ethanimidamide |
| SMILES | C=C/C(=C\N/C(C)=N/Cc1cc(F)ccc1F)CC(=C)/C(=C/C(F)=C\N)C(=C)NC |
| InChI | InChI=1S/C23H27F3N4/c1-6-18(9-15(2)22(16(3)28-5)11-21(25)12-27)13-29-17(4)30-14-19-10-20(24)7-8-23(19)26/h6-8,10-13,28H,1-3,9,14,27H2,4-5H3,(H,29,30)/b18-13+,21-12+,22-11- |
| InChIKey | LBDWFXPMBJCVBE-ICWMWURESA-N |
| XLogP | 4.92 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|