C20H29F2N3 — CID 89270667
N-[(3E,5Z)-3,7-difluoroocta-3,5,7-trienyl]-4-methyl-5-[(5-methylidenepyrrolidin-3-yl)methyl]-1,2,3,4-tetrahydropyridin-2-amine (PubChem CID 89270667) has the molecular formula C20H29F2N3 and a molecular weight of 349.47 g/mol. Its IUPAC name is N-[(3E,5Z)-3,7-difluoroocta-3,5,7-trienyl]-4-methyl-5-[(5-methylidenepyrrolidin-3-yl)methyl]-1,2,3,4-tetrahydropyridin-2-amine.
| Compound Name | N-[(3E,5Z)-3,7-difluoroocta-3,5,7-trienyl]-4-methyl-5-[(5-methylidenepyrrolidin-3-yl)methyl]-1,2,3,4-tetrahydropyridin-2-amine |
|---|---|
| PubChem CID | 89270667 |
| Molecular Formula | C20H29F2N3 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | N-[(3E,5Z)-3,7-difluoroocta-3,5,7-trienyl]-4-methyl-5-[(5-methylidenepyrrolidin-3-yl)methyl]-1,2,3,4-tetrahydropyridin-2-amine |
| SMILES | C=C(F)/C=C\C=C(\F)CCNC1CC(C)C(CC2CNC(=C)C2)=CN1 |
| InChI | InChI=1S/C20H29F2N3/c1-14-9-20(23-8-7-19(22)6-4-5-15(2)21)25-13-18(14)11-17-10-16(3)24-12-17/h4-6,13-14,17,20,23-25H,2-3,7-12H2,1H3/b5-4-,19-6+ |
| InChIKey | JXMLMFQUFJQZSG-KYCOTQASSA-N |
| XLogP | 4.21 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|