About (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine
(E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine (PubChem CID 89270688) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine |
| PubChem CID | 89270688 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine |
| SMILES | N/C=C/CC1=CNC2NC=CC=C12 |
| InChI | InChI=1S/C10H13N3/c11-5-1-3-8-7-13-10-9(8)4-2-6-12-10/h1-2,4-7,10,12-13H,3,11H2/b5-1+ |
| InChIKey | HRGRRJJKQOBPHC-ORCRQEGFSA-N |
| XLogP | 0.71 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine?
The IUPAC name of (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine (CID 89270688) is (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine.
What is the SMILES notation for (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine?
The canonical SMILES for (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine is N/C=C/CC1=CNC2NC=CC=C12.
What is the InChIKey of (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine?
The InChIKey is HRGRRJJKQOBPHC-ORCRQEGFSA-N. The full InChI is InChI=1S/C10H13N3/c11-5-1-3-8-7-13-10-9(8)4-2-6-12-10/h1-2,4-7,10,12-13H,3,11H2/b5-1+.
What are the key properties of (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine?
(E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine has a molecular weight of 175.24 g/mol, XLogP of 0.71, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-1-en-1-amine is sourced from PubChem (CID 89270688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).