C12H23N3 — CID 89270691
2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)but-3-en-1-amine (PubChem CID 89270691) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)but-3-en-1-amine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 89270691 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)but-3-en-1-amine |
| SMILES | C=CC(CN)CC1CNC2NCCCC12 |
| InChI | InChI=1S/C12H23N3/c1-2-9(7-13)6-10-8-15-12-11(10)4-3-5-14-12/h2,9-12,14-15H,1,3-8,13H2 |
| InChIKey | LUZDJFWBFLBERF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|