C23H28ClFN4 — CID 89270695
(1Z,3Z)-2-[[(4Z)-4-[(Z)-3-aminoprop-2-enylidene]-5-methylidene-1H-pyrrol-3-yl]methyl]-5-N-[(3E,5E)-6-chloro-4-fluoroocta-3,5,7-trienyl]hexa-1,3,5-triene-1,5-diamine (PubChem CID 89270695) has the molecular formula C23H28ClFN4 and a molecular weight of 414.96 g/mol. Its IUPAC name is (1Z,3Z)-2-[[(4Z)-4-[(Z)-3-aminoprop-2-enylidene]-5-methylidene-1H-pyrrol-3-yl]methyl]-5-N-[(3E,5E)-6-chloro-4-fluoroocta-3,5,7-trienyl]hexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3Z)-2-[[(4Z)-4-[(Z)-3-aminoprop-2-enylidene]-5-methylidene-1H-pyrrol-3-yl]methyl]-5-N-[(3E,5E)-6-chloro-4-fluoroocta-3,5,7-trienyl]hexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 89270695 |
| Molecular Formula | C23H28ClFN4 |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (1Z,3Z)-2-[[(4Z)-4-[(Z)-3-aminoprop-2-enylidene]-5-methylidene-1H-pyrrol-3-yl]methyl]-5-N-[(3E,5E)-6-chloro-4-fluoroocta-3,5,7-trienyl]hexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C/C(Cl)=C\C(F)=C/CCNC(=C)/C=C\C(=C/N)Cc1c[nH]c(=C)/c1=C\C=C/N |
| InChI | InChI=1S/C23H28ClFN4/c1-4-21(24)14-22(25)7-6-12-28-17(2)9-10-19(15-27)13-20-16-29-18(3)23(20)8-5-11-26/h4-5,7-11,14-16,28-29H,1-3,6,12-13,26-27H2/b10-9-,11-5-,19-15+,21-14+,22-7+,23-8+ |
| InChIKey | KZQBUZHNHDGIIX-SNSDIIGRSA-N |
| XLogP | 3.27 |
| TPSA | 79.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|