About 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one
1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one (PubChem CID 89270771) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one.
Molecular Properties
| Compound Name | 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one |
| PubChem CID | 89270771 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one |
| SMILES | O=C1CCC2=CCCC3=C2N1CC3 |
| InChI | InChI=1S/C11H13NO/c13-10-5-4-8-2-1-3-9-6-7-12(10)11(8)9/h2H,1,3-7H2 |
| InChIKey | CESGFTLQLXLKJM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one?
The IUPAC name of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one (CID 89270771) is 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one.
What is the SMILES notation for 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one?
The canonical SMILES for 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one is O=C1CCC2=CCCC3=C2N1CC3.
What is the InChIKey of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one?
The InChIKey is CESGFTLQLXLKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c13-10-5-4-8-2-1-3-9-6-7-12(10)11(8)9/h2H,1,3-7H2.
What are the key properties of 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one?
1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one has a molecular weight of 175.23 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[6.3.1.04,12]dodeca-4(12),7-dien-11-one is sourced from PubChem (CID 89270771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).