About 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal
2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal (PubChem CID 89270773) has the molecular formula C6H3F5O3
and a molecular weight of 218.08 g/mol. Its IUPAC name is 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal.
Molecular Properties
| Compound Name | 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal |
| PubChem CID | 89270773 |
| Molecular Formula | C6H3F5O3 |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal |
| SMILES | O=CC(C(=O)C(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H3F5O3/c7-5(8)3(13)2(1-12)4(14)6(9,10)11/h1-2,5H |
| InChIKey | RMHMCBAJIPMJRL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal?
The IUPAC name of 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal (CID 89270773) is 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal.
What is the SMILES notation for 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal?
The canonical SMILES for 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal is O=CC(C(=O)C(F)F)C(=O)C(F)(F)F.
What is the InChIKey of 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal?
The InChIKey is RMHMCBAJIPMJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F5O3/c7-5(8)3(13)2(1-12)4(14)6(9,10)11/h1-2,5H.
What are the key properties of 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal?
2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal has a molecular weight of 218.08 g/mol, XLogP of 0.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroacetyl)-4,4,4-trifluoro-3-oxobutanal is sourced from PubChem (CID 89270773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).