C28H25F2N9O2 — CID 89270865
2-methylbut-3-yn-2-yl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate (PubChem CID 89270865) has the molecular formula C28H25F2N9O2 and a molecular weight of 557.57 g/mol. Its IUPAC name is 2-methylbut-3-yn-2-yl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate.
| Compound Name | 2-methylbut-3-yn-2-yl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 89270865 |
| Molecular Formula | C28H25F2N9O2 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 2-methylbut-3-yn-2-yl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate |
| SMILES | C#CC(C)(C)OC(=O)N1CC(Cn2cc(-c3cnc4ccc(C(F)(F)c5nnc6ncc(C)nn56)cc4c3)cn2)C1 |
| InChI | InChI=1S/C28H25F2N9O2/c1-5-27(3,4)41-26(40)37-13-18(14-37)15-38-16-21(12-33-38)20-8-19-9-22(6-7-23(19)31-11-20)28(29,30)24-34-35-25-32-10-17(2)36-39(24)25/h1,6-12,16,18H,13-15H2,2-4H3 |
| InChIKey | IKZGYHYSMIHIDZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 116.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|