About 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal
3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal (PubChem CID 89270870) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal.
Molecular Properties
| Compound Name | 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal |
| PubChem CID | 89270870 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal |
| SMILES | O=CCCn1c2c(oc1=O)C=CCC2 |
| InChI | InChI=1S/C10H11NO3/c12-7-3-6-11-8-4-1-2-5-9(8)14-10(11)13/h2,5,7H,1,3-4,6H2 |
| InChIKey | GSKSEUPGQBCHAX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal?
The IUPAC name of 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal (CID 89270870) is 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal.
What is the SMILES notation for 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal?
The canonical SMILES for 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal is O=CCCn1c2c(oc1=O)C=CCC2.
What is the InChIKey of 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal?
The InChIKey is GSKSEUPGQBCHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c12-7-3-6-11-8-4-1-2-5-9(8)14-10(11)13/h2,5,7H,1,3-4,6H2.
What are the key properties of 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal?
3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal has a molecular weight of 193.20 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-4,5-dihydro-1,3-benzoxazol-3-yl)propanal is sourced from PubChem (CID 89270870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).