C27H24FN9O2 — CID 89270970
2-methylbut-3-yn-2-yl 3-[4-[6-[fluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]azetidine-1-carboxylate (PubChem CID 89270970) has the molecular formula C27H24FN9O2 and a molecular weight of 525.55 g/mol. Its IUPAC name is 2-methylbut-3-yn-2-yl 3-[4-[6-[fluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]azetidine-1-carboxylate.
| Compound Name | 2-methylbut-3-yn-2-yl 3-[4-[6-[fluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 89270970 |
| Molecular Formula | C27H24FN9O2 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 2-methylbut-3-yn-2-yl 3-[4-[6-[fluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]azetidine-1-carboxylate |
| SMILES | C#CC(C)(C)OC(=O)N1CC(n2cc(-c3cnc4ccc(C(F)c5nnc6ncc(C)nn56)cc4c3)cn2)C1 |
| InChI | InChI=1S/C27H24FN9O2/c1-5-27(3,4)39-26(38)35-14-21(15-35)36-13-20(12-31-36)19-9-18-8-17(6-7-22(18)29-11-19)23(28)24-32-33-25-30-10-16(2)34-37(24)25/h1,6-13,21,23H,14-15H2,2-4H3 |
| InChIKey | SMHAXFDQICBWTL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 116.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|