C9H11FO — CID 89271005
(3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-2-one (PubChem CID 89271005) has the molecular formula C9H11FO and a molecular weight of 154.18 g/mol. Its IUPAC name is (3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-2-one.
| Compound Name | (3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 89271005 |
| Molecular Formula | C9H11FO |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | (3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-2-one |
| SMILES | C=C/C(F)=C\C=C(/C)C(C)=O |
| InChI | InChI=1S/C9H11FO/c1-4-9(10)6-5-7(2)8(3)11/h4-6H,1H2,2-3H3/b7-5+,9-6+ |
| InChIKey | SEYXDMWHNMOXBF-PDTNFJSOSA-N |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|