C13H18N2O — CID 89271071
3-[(5Z,6E)-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]oxypropan-1-amine (PubChem CID 89271071) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-[(5Z,6E)-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]oxypropan-1-amine.
| Compound Name | 3-[(5Z,6E)-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 89271071 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-[(5Z,6E)-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]oxypropan-1-amine |
| SMILES | C=C/C=c1/c(OCCCN)ccc/c1=C/N |
| InChI | InChI=1S/C13H18N2O/c1-2-5-12-11(10-15)6-3-7-13(12)16-9-4-8-14/h2-3,5-7,10H,1,4,8-9,14-15H2/b11-10-,12-5+ |
| InChIKey | FKICYGOMXBKNGA-MZISSHJSSA-N |
| XLogP | 0.08 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|