About (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine
(E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine (PubChem CID 89271099) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine.
Molecular Properties
| Compound Name | (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine |
| PubChem CID | 89271099 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine |
| SMILES | C/C=C(\CCC(C)N)C1=NC=CCC1 |
| InChI | InChI=1S/C12H20N2/c1-3-11(8-7-10(2)13)12-6-4-5-9-14-12/h3,5,9-10H,4,6-8,13H2,1-2H3/b11-3+ |
| InChIKey | JYHVOZBAXNJRTO-QDEBKDIKSA-N |
| XLogP | 2.81 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine?
The IUPAC name of (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine (CID 89271099) is (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine.
What is the SMILES notation for (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine?
The canonical SMILES for (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine is C/C=C(\CCC(C)N)C1=NC=CCC1.
What is the InChIKey of (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine?
The InChIKey is JYHVOZBAXNJRTO-QDEBKDIKSA-N. The full InChI is InChI=1S/C12H20N2/c1-3-11(8-7-10(2)13)12-6-4-5-9-14-12/h3,5,9-10H,4,6-8,13H2,1-2H3/b11-3+.
What are the key properties of (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine?
(E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine has a molecular weight of 192.31 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(3,4-dihydropyridin-2-yl)hept-5-en-2-amine is sourced from PubChem (CID 89271099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).