C7H10O4 — CID 89271123
(2E,3S,5R)-2-(hydroxymethylidene)-4-methylideneoxane-3,5-diol (PubChem CID 89271123) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (2E,3S,5R)-2-(hydroxymethylidene)-4-methylideneoxane-3,5-diol.
| Compound Name | (2E,3S,5R)-2-(hydroxymethylidene)-4-methylideneoxane-3,5-diol |
|---|---|
| PubChem CID | 89271123 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (2E,3S,5R)-2-(hydroxymethylidene)-4-methylideneoxane-3,5-diol |
| SMILES | C=C1[C@@H](O)CO/C(=C/O)[C@H]1O |
| InChI | InChI=1S/C7H10O4/c1-4-5(9)3-11-6(2-8)7(4)10/h2,5,7-10H,1,3H2/b6-2+/t5-,7-/m0/s1 |
| InChIKey | PNWUYVJJVBHKKW-YWDJJHPESA-N |
| XLogP | -0.31 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|