About 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene
7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene (PubChem CID 89271149) has the molecular formula C18H18O3S
and a molecular weight of 314.41 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene |
| PubChem CID | 89271149 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene |
| SMILES | C=C1CC(C)(C)Oc2cc(S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C18H18O3S/c1-13-12-18(2,3)21-17-11-15(9-10-16(13)17)22(19,20)14-7-5-4-6-8-14/h4-11H,1,12H2,2-3H3 |
| InChIKey | IEFJRGVVCLMXBB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene?
The IUPAC name of 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene (CID 89271149) is 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene.
What is the SMILES notation for 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene?
The canonical SMILES for 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene is C=C1CC(C)(C)Oc2cc(S(=O)(=O)c3ccccc3)ccc21.
What is the InChIKey of 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene?
The InChIKey is IEFJRGVVCLMXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3S/c1-13-12-18(2,3)21-17-11-15(9-10-16(13)17)22(19,20)14-7-5-4-6-8-14/h4-11H,1,12H2,2-3H3.
What are the key properties of 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene?
7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene has a molecular weight of 314.41 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-2,2-dimethyl-4-methylidene-3H-chromene is sourced from PubChem (CID 89271149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).