C25H30F2INO — CID 89271848
(8E)-2-[2-fluoro-4-(5-fluoro-2-pyridinyl)phenyl]-4-iodo-9,11-dimethyldodeca-8,10-dien-2-ol (PubChem CID 89271848) has the molecular formula C25H30F2INO and a molecular weight of 525.42 g/mol. Its IUPAC name is (8E)-2-[2-fluoro-4-(5-fluoro-2-pyridinyl)phenyl]-4-iodo-9,11-dimethyldodeca-8,10-dien-2-ol.
| Compound Name | (8E)-2-[2-fluoro-4-(5-fluoro-2-pyridinyl)phenyl]-4-iodo-9,11-dimethyldodeca-8,10-dien-2-ol |
|---|---|
| PubChem CID | 89271848 |
| Molecular Formula | C25H30F2INO |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | (8E)-2-[2-fluoro-4-(5-fluoro-2-pyridinyl)phenyl]-4-iodo-9,11-dimethyldodeca-8,10-dien-2-ol |
| SMILES | CC(C)=C/C(C)=C/CCCC(I)CC(C)(O)c1ccc(-c2ccc(F)cn2)cc1F |
| InChI | InChI=1S/C25H30F2INO/c1-17(2)13-18(3)7-5-6-8-21(28)15-25(4,30)22-11-9-19(14-23(22)27)24-12-10-20(26)16-29-24/h7,9-14,16,21,30H,5-6,8,15H2,1-4H3/b18-7+ |
| InChIKey | IRPMUDHWQKGHDC-CNHKJKLMSA-N |
| XLogP | 7.51 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|