C6H10IN — CID 89271864
4-iodo-3-methyl-2,3,4,5-tetrahydropyridine (PubChem CID 89271864) has the molecular formula C6H10IN and a molecular weight of 223.06 g/mol. Its IUPAC name is 4-iodo-3-methyl-2,3,4,5-tetrahydropyridine.
| Compound Name | 4-iodo-3-methyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 89271864 |
| Molecular Formula | C6H10IN |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 4-iodo-3-methyl-2,3,4,5-tetrahydropyridine |
| SMILES | CC1CN=CCC1I |
| InChI | InChI=1S/C6H10IN/c1-5-4-8-3-2-6(5)7/h3,5-6H,2,4H2,1H3 |
| InChIKey | INNDCAMVPNMATR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|