C18H14FN3 — CID 89271957
9-(4-fluorophenyl)carbazole-3,6-diamine (PubChem CID 89271957) has the molecular formula C18H14FN3 and a molecular weight of 291.33 g/mol. Its IUPAC name is 9-(4-fluorophenyl)carbazole-3,6-diamine.
| Compound Name | 9-(4-fluorophenyl)carbazole-3,6-diamine |
|---|---|
| PubChem CID | 89271957 |
| Molecular Formula | C18H14FN3 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 9-(4-fluorophenyl)carbazole-3,6-diamine |
| SMILES | Nc1ccc2c(c1)c1cc(N)ccc1n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FN3/c19-11-1-5-14(6-2-11)22-17-7-3-12(20)9-15(17)16-10-13(21)4-8-18(16)22/h1-10H,20-21H2 |
| InChIKey | VYGSZVWGNGINAR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|