About 9-(4-fluorophenyl)carbazole-3,6-diamine
9-(4-fluorophenyl)carbazole-3,6-diamine (PubChem CID 89271957) has the molecular formula C18H14FN3
and a molecular weight of 291.33 g/mol. Its IUPAC name is 9-(4-fluorophenyl)carbazole-3,6-diamine.
Molecular Properties
| Compound Name | 9-(4-fluorophenyl)carbazole-3,6-diamine |
| PubChem CID | 89271957 |
| Molecular Formula | C18H14FN3 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 9-(4-fluorophenyl)carbazole-3,6-diamine |
| SMILES | Nc1ccc2c(c1)c1cc(N)ccc1n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FN3/c19-11-1-5-14(6-2-11)22-17-7-3-12(20)9-15(17)16-10-13(21)4-8-18(16)22/h1-10H,20-21H2 |
| InChIKey | VYGSZVWGNGINAR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-fluorophenyl)carbazole-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-fluorophenyl)carbazole-3,6-diamine?
The IUPAC name of 9-(4-fluorophenyl)carbazole-3,6-diamine (CID 89271957) is 9-(4-fluorophenyl)carbazole-3,6-diamine.
What is the SMILES notation for 9-(4-fluorophenyl)carbazole-3,6-diamine?
The canonical SMILES for 9-(4-fluorophenyl)carbazole-3,6-diamine is Nc1ccc2c(c1)c1cc(N)ccc1n2-c1ccc(F)cc1.
What is the InChIKey of 9-(4-fluorophenyl)carbazole-3,6-diamine?
The InChIKey is VYGSZVWGNGINAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN3/c19-11-1-5-14(6-2-11)22-17-7-3-12(20)9-15(17)16-10-13(21)4-8-18(16)22/h1-10H,20-21H2.
What are the key properties of 9-(4-fluorophenyl)carbazole-3,6-diamine?
9-(4-fluorophenyl)carbazole-3,6-diamine has a molecular weight of 291.33 g/mol, XLogP of 4.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-fluorophenyl)carbazole-3,6-diamine is sourced from PubChem (CID 89271957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).